| ID: | N5396 | |
|---|---|---|
| Name: | 1,2-dimethylbenzene, 1-ethyl-3-methylimidazolium diethylphosphate | |
| Description: | 1,2-dimethylbenzene [MEIm]+[E2PO4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C8H10.C6H11N2.C4H11O4P/c1-7-5-3-4-6-8(7)2;1-3-8-5-4-7(2)6-8;1-3-7-9(5,6)8-4-2/h3-6H,1-2H3;4-6H,3H2,1-2H3;3-4H2,1-2H3,(H,5,6)/q;+1;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.599199129451863 |
experimental value |
| 3.379933882068578 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.679189971104941 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |