| ID: | N5246 | |
|---|---|---|
| Name: | 1,3-dimethylbenzene, 1-allyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide | |
| Description: | 1,3-dimethylbenzene [AllMIm]+[(Tf)2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C8H10.C7H11N2.C2F6NO4S2/c1-7-4-3-5-8(2)6-7;1-3-4-9-6-5-8(2)7-9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-6H,1-2H3;3,5-7H,1,4H2,2H3;/q;+1;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.523 |
experimental value |
| 3.392292167969266 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.495943434789238 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |