| ID: | N5181 | |
|---|---|---|
| Name: | 1-pentanol, 1-(2-hydroxyethyl)-3-methylimidazolium tetrafluoroborate | |
| Description: | 1-pentanol [EtOHMIM]+[BF4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C6H11N2O.C5H12O.BF4/c1-7-2-3-8(6-7)4-5-9;1-2-3-4-5-6;2-1(3,4)5/h2-3,6,9H,4-5H2,1H3;6H,2-5H2,1H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.492 |
experimental value |
| 3.319895664985438 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.697951274172778 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |