| ID: | N4891 | |
|---|---|---|
| Name: | butyl acetate, 1-(methylethylether)-3-methylimidazolium bis(trifluoromethylsulfonyl)imide | |
| Description: | butyl acetate [MeoeMIm]+[Tf2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C7H13N2O.C6H12O2.C2F6NO4S2/c1-8-3-4-9(7-8)5-6-10-2;1-3-4-5-8-6(2)7;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-4,7H,5-6H2,1-2H3;3-5H2,1-2H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.381828859366547 |
experimental value |
| 3.348143719593597 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.887350126751825 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |