| ID: | N4826 | |
|---|---|---|
| Name: | styrene, 1-propyl-2,3-dimethylimidazolium tetrafluoroborate | |
| Description: | styrene [PM2Im]+[BF4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C8H15N2.C8H8.BF4/c1-4-5-10-7-6-9(3)8(10)2;1-2-8-6-4-3-5-7-8;2-1(3,4)5/h6-7H,4-5H2,1-3H3;2-7H,1H2;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.359 |
experimental value |
| 3.439695649239569 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.708746409213777 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |