| ID: | N4776 | |
|---|---|---|
| Name: | ethylbenzene, 1-hexyl-3-methylimidazolium nitrate | |
| Description: | ethylbenzene [HMIm]+[NO3]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H19N2.C8H10.NO3/c1-3-4-5-6-7-12-9-8-11(2)10-12;1-2-8-6-4-3-5-7-8;2-1(3)4/h8-10H,3-7H2,1-2H3;3-7H,2H2,1H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.343 |
experimental value |
| 3.350904495119015 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.348617514901361 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |