| ID: | N4516 | |
|---|---|---|
| Name: | 1,4-dimethylbenzene, 1-hexyl-3-methylimidazolium hexafluorophosphate | |
| Description: | 1,4-dimethylbenzene [MHIm]+[PF6]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H19N2.C8H10.F6P/c1-3-4-5-6-7-12-9-8-11(2)10-12;1-7-3-5-8(2)6-4-7;1-7(2,3,4,5)6/h8-10H,3-7H2,1-2H3;3-6H,1-2H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.233 |
experimental value |
| 3.250067716908184 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.345614793071805 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |