| ID: | N4506 | |
|---|---|---|
| Name: | thiophene, 1,3-dimethylimidazolium methylphosphonate | |
| Description: | thiophene [M2Im]+[(MeO)(H)PO2]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C5H9N2.C4H4S.CH5O3P/c1-6-3-4-7(2)5-6;1-2-4-5-3-1;1-4-5(2)3/h3-5H,1-2H3;1-4H;5H,1H3,(H,2,3)/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.229 |
experimental value |
| 2.417523197254944 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.057289135686395 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |