| ID: | N4436 | |
|---|---|---|
| Name: | dibutyl ether, 3-methyl-n-butylpyridinium 4,5-dicyano-2-(trifluoromethyl)imidazolide | |
| Description: | dibutyl ether [3-MBPy]+[TDI]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H16N.C8H18O.C6F3N4/c1-3-4-7-11-8-5-6-10(2)9-11;1-3-5-7-9-8-6-4-2;7-6(8,9)5-12-3(1-10)4(2-11)13-5/h5-6,8-9H,3-4,7H2,1-2H3;3-8H2,1-2H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.199 |
experimental value |
| 3.390047688010251 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.12611631182786 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |