| ID: | N4201 | |
|---|---|---|
| Name: | ethanol, 1-ethyl-3-methylimidazolium triflate | |
| Description: | ethanol [MEIm]+[CF3SO3]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C6H11N2.C2H6O.CHF3O3S/c1-3-8-5-4-7(2)6-8;1-2-3;2-1(3,4)8(5,6)7/h4-6H,3H2,1-2H3;3H,2H2,1H3;(H,5,6,7)/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.115 |
experimental value |
| 2.629814202235291 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.141853595326009 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |