| ID: | N416 | |
|---|---|---|
| Name: | methylcyclohexane, 1-allyl-3-methylimidazolium dicyanamide | |
| Description: | methylcyclohexane [AllMIm]+[N(CN)2]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C7H11N2.C7H14.C2N3/c1-3-4-9-6-5-8(2)7-9;1-7-5-3-2-4-6-7;3-1-5-2-4/h3,5-7H,1,4H2,2H3;7H,2-6H2,1H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 1.198 |
experimental value |
| 1.967281657861224 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 1.25530970948497 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |