| ID: | N4076 | |
|---|---|---|
| Name: | 1,2-dichloroethane, 1-hexyl-3-methylimidazolium nitrate | |
| Description: | 1,2-dichloroethane [HMIm]+[NO3]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H19N2.C2H4Cl2.NO3/c1-3-4-5-6-7-12-9-8-11(2)10-12;3-1-2-4;2-1(3)4/h8-10H,3-7H2,1-2H3;1-2H2;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.068 |
experimental value |
| 2.448294103799261 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.539643023516298 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |