| ID: | N4006 | |
|---|---|---|
| Name: | thiophene, 1-butyl-1-methylmorpholinium tricyanomethanide | |
| Description: | thiophene [BMMorp]+[C(CN)3]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H20NO.C4N3.C4H4S/c1-3-4-5-10(2)6-8-11-9-7-10;5-1-4(2-6)3-7;1-2-4-5-3-1/h3-9H2,1-2H3;;1-4H/q+1;-1; |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.042622843815624 |
experimental value |
| 2.786099280984947 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.0363706972757 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |