| ID: | N3391 | |
|---|---|---|
| Name: | ethanol, 1-hexadecyl-3-methylimidazolium tetrafluoroborate | |
| Description: | ethanol [HexdMIm]+[BF4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C20H39N2.C2H6O.BF4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-19-18-21(2)20-22;1-2-3;2-1(3,4)5/h18-20H,3-17H2,1-2H3;3H,2H2,1H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.83 |
experimental value |
| 3.0123166561371 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.767068551482232 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |