| ID: | N3306 | |
|---|---|---|
| Name: | tetrahydrofuran, 1,3,4,6,7,8-hexahydro-1-methyl-2h-pyrimido[1,2-a]pyrimidine bis(pentafluoroethylsulfonyl)imide | |
| Description: | tetrahydrofuran [MTBDH]+[BETI]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C8H16N3.C4F10NO4S2.C4H8O/c1-10-5-3-7-11-6-2-4-9-8(10)11;5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10;1-2-4-5-3-1/h9H,2-7H2,1H3;;1-4H2/q+1;-1; |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.79926367886452 |
experimental value |
| 2.935866133688517 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.846320620319424 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |