| ID: | N2886 | |
|---|---|---|
| Name: | propanone, n-butyl-n-methylpyrrolidinium dicyanamide | |
| Description: | propanone [BMPyrr]+[N(CN)2]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H20N.C3H6O.C2N3/c1-3-4-7-10(2)8-5-6-9-10;1-3(2)4;3-1-5-2-4/h3-9H2,1-2H3;1-2H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.654 |
experimental value |
| 2.475036795220669 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.556333498009881 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |