| ID: | N2881 | |
|---|---|---|
| Name: | methyl tert-pentyl ether, 3-methyl-n-butylpyridinium 4,5-dicyano-2-(trifluoromethyl)imidazolide | |
| Description: | methyl tert-pentyl ether [3-MBPy]+[TDI]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H16N.C6F3N4.C6H14O/c1-3-4-7-11-8-5-6-10(2)9-11;7-6(8,9)5-12-3(1-10)4(2-11)13-5;1-5-6(2,3)7-4/h5-6,8-9H,3-4,7H2,1-2H3;;5H2,1-4H3/q+1;-1; |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.651 |
experimental value |
| 2.410395592019254 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.551035894237168 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |