| ID: | N2391 | |
|---|---|---|
| Name: | 3-pentanone, 1-ethyl-3-methylimidazolium methanesulfonate | |
| Description: | 3-pentanone [EMIm]+[MeSO3]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C6H11N2.C5H10O.CH4O3S/c1-3-8-5-4-7(2)6-8;1-3-5(6)4-2;1-5(2,3)4/h4-6H,3H2,1-2H3;3-4H2,1-2H3;1H3,(H,2,3,4)/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.438550238191672 |
experimental value |
| 2.448795667294518 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.546758765984669 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |