| ID: | N2331 | |
|---|---|---|
| Name: | octane, 1-octyl-3-methylimidazolium hexafluorophosphate | |
| Description: | octane [MOIm]+[PF6]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C12H23N2.C8H18.F6P/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;1-3-5-7-8-6-4-2;1-7(2,3,4,5)6/h10-12H,3-9H2,1-2H3;3-8H2,1-2H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.407 |
experimental value |
| 1.780455621618583 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.387289315101061 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |