| ID: | N2321 | |
|---|---|---|
| Name: | methylcyclohexane, n-decyl-n-methylpyrrolidinium bis(trifluoromethylsulfonyl)imide | |
| Description: | methylcyclohexane [C10MPyrr]+[Tf2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C15H32N.C7H14.C2F6NO4S2/c1-3-4-5-6-7-8-9-10-13-16(2)14-11-12-15-16;1-7-5-3-2-4-6-7;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-15H2,1-2H3;7H,2-6H2,1H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.40004262437115 |
experimental value |
| 2.334483998297316 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.33013340391556 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |