| ID: | N2316 | |
|---|---|---|
| Name: | 1,3-cyclohexadiene, 1-butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide | |
| Description: | 1,3-cyclohexadiene [MBIm]+[Tf2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C8H15N2.C6H8.C2F6NO4S2/c1-3-4-5-10-7-6-9(2)8-10;1-2-4-6-5-3-1;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6-8H,3-5H2,1-2H3;1-4H,5-6H2;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.398 |
experimental value |
| 2.568293714183314 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.570912764070773 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |