| ID: | N21 | |
|---|---|---|
| Name: | ethene, 1-octyl-3-methylimidazolium tetrafluoroborate | |
| Description: | ethene [MOIm]+[BF4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C12H23N2.C2H4.BF4/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;1-2;2-1(3,4)5/h10-12H,3-9H2,1-2H3;1-2H2;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| -0.13 |
experimental value |
| 0.8622021763951404 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| -0.06647766666666674 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |