| ID: | N2046 | |
|---|---|---|
| Name: | benzene, 1-(3-cyanopropyl)-1-methylpyrroldinium thiocyanate | |
| Description: | benzene [PrCNMPyrr]+[SCN]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H17N2.C6H6.CHNS/c1-11(7-3-2-6-10)8-4-5-9-11;1-2-4-6-5-3-1;2-1-3/h2-5,7-9H2,1H3;1-6H;3H/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.266296318144977 |
experimental value |
| 2.509986541137777 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.320289924695914 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |