| ID: | N201 | |
|---|---|---|
| Name: | 1-pentene, n-butyl-n-methylpyrrolidinium triflate | |
| Description: | 1-pentene [BMPyrr]+[Trif]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H20N.C5H10.CHF3O3S/c1-3-4-7-10(2)8-5-6-9-10;1-3-5-4-2;2-1(3,4)8(5,6)7/h3-9H2,1-2H3;3H,1,4-5H2,2H3;(H,5,6,7)/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 0.851 |
experimental value |
| 1.281660041233088 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 0.971055954864616 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |