| ID: | N191 | |
|---|---|---|
| Name: | tert-butyl methyl ether, 1-hydroxyethyl-1-methylmorpholinium dicyanamide | |
| Description: | tert-butyl methyl ether [EtOHMMorp]+[N(CN)2]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C7H16NO2.C5H12O.C2N3/c1-8(2-5-9)3-6-10-7-4-8;1-5(2,3)6-4;3-1-5-2-4/h9H,2-7H2,1H3;1-4H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 0.8205877454245252 |
experimental value |
| 1.816725738196275 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 0.9587371626078671 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |