| ID: | N1906 | |
|---|---|---|
| Name: | 1-hexyne, n-hexylisoquinolinium thiocyanate | |
| Description: | 1-hexyne [HiQu]+[SCN]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C15H20N.C6H10.CHNS/c1-2-3-4-7-11-16-12-10-14-8-5-6-9-15(14)13-16;1-3-5-6-4-2;2-1-3/h5-6,8-10,12-13H,2-4,7,11H2,1H3;1H,4-6H2,2H3;3H/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.201979473174763 |
experimental value |
| 1.96068235034286 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.236466955941328 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |