| ID: | N1736 | |
|---|---|---|
| Name: | cyclohexane, 1-decyl-3-methylimidazolium tetracyanoborate | |
| Description: | cyclohexane [MDIm]+[B(CN)4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C14H27N2.C6H12.C4BN4/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;1-2-4-6-5-3-1;6-1-5(2-7,3-8)4-9/h12-14H,3-11H2,1-2H3;1-6H2;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.115 |
experimental value |
| 2.170784521605284 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.09243024343519 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |