| ID: | N1556 | |
|---|---|---|
| Name: | 1-pentyne, 3-methyl-n-butylpyridinium 4,5-dicyano-2-(trifluoromethyl)imidazolide | |
| Description: | 1-pentyne [3-MBPy]+[TDI]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H16N.C6F3N4.C5H8/c1-3-4-7-11-8-5-6-10(2)9-11;7-6(8,9)5-12-3(1-10)4(2-11)13-5;1-3-5-4-2/h5-6,8-9H,3-4,7H2,1-2H3;;1H,4-5H2,2H3/q+1;-1; |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.003 |
experimental value |
| 2.069140866837157 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 1.885978939320388 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |