| ID: | N1406 | |
|---|---|---|
| Name: | cyclohexene, 1-butyl-3-methylimidazolium triflate | |
| Description: | cyclohexene [MBIm]+[CF3SO3]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C8H15N2.C6H10.CHF3O3S/c1-3-4-5-10-7-6-9(2)8-10;1-2-4-6-5-3-1;2-1(3,4)8(5,6)7/h6-8H,3-5H2,1-2H3;1-2H,3-6H2;(H,5,6,7)/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 1.928 |
experimental value |
| 2.176132732004283 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 1.975738617072058 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |