| ID: | N1136 | |
|---|---|---|
| Name: | 1-hexene, 1-hexyloxymethyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide | |
| Description: | 1-hexene [HexomMIm]+[Tf2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C11H21N2O.C6H12.C2F6NO4S2/c1-3-4-5-6-9-14-11-13-8-7-12(2)10-13;1-3-5-6-4-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7-8,10H,3-6,9,11H2,1-2H3;3H,1,4-6H2,2H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 1.77 |
experimental value |
| 1.467386650297758 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 1.789921933240551 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |