| ID: | N1066 | |
|---|---|---|
| Name: | 1-hexene, 1-hexyl-3-methylimidazolium tetracyanoborate | |
| Description: | 1-hexene [MHIm]+[B(CN)4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H19N2.C6H12.C4BN4/c1-3-4-5-6-7-12-9-8-11(2)10-12;1-3-5-6-4-2;6-1-5(2-7,3-8)4-9/h8-10H,3-7H2,1-2H3;3H,1,4-6H2,2H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 1.73 |
experimental value |
| 1.656666738027887 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 1.699807548844437 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |