| ID: | e5189 | |
|---|---|---|
| Name: | 2-(2-Ethoxyethoxy)ethyl acetate | |
| Description: | ||
| Labels: | ||
| CAS: | 112-15-2 | |
| InChi Code: | InChI=1S/C8H16O4/c1-3-10-4-5-11-6-7-12-8(2)9/h3-7H2,1-2H3 |
Antagonists: Activity in AR antagonist pathway
| Value | Source or prediction |
|---|---|
| inactive |
experimental value |
| inactive |
Antagonists_model: Antagonist model (Evaluation set) |