| ID: | e5102 | |
|---|---|---|
| Name: | 3-Hydroxy-4-butyrophenetidide | |
| Description: | ||
| Labels: | ||
| CAS: | 1083-57-4 | |
| InChi Code: | InChI=1S/C12H17NO3/c1-3-16-11-6-4-10(5-7-11)13-12(15)8-9(2)14/h4-7,9,14H,3,8H2,1-2H3,(H,13,15) |
Antagonists: Activity in AR antagonist pathway
| Value | Source or prediction |
|---|---|
| inactive |
experimental value |
| inactive |
Antagonists_model: Antagonist model (Evaluation set) |