| ID: | e5094 | |
|---|---|---|
| Name: | Pizotyline | |
| Description: | ||
| Labels: | ||
| CAS: | 15574-96-6 | |
| InChi Code: | InChI=1S/C19H21NS/c1-20-11-8-15(9-12-20)19-16-5-3-2-4-14(16)6-7-18-17(19)10-13-21-18/h2-5,10,13H,6-9,11-12H2,1H3 |
Antagonists: Activity in AR antagonist pathway
| Value | Source or prediction |
|---|---|
| inactive |
experimental value |
| antagonist |
Antagonists_model: Antagonist model (Evaluation set) |