| ID: | e5046 | |
|---|---|---|
| Name: | Primidone | |
| Description: | ||
| Labels: | ||
| CAS: | 125-33-7 | |
| InChi Code: | InChI=1S/C12H14N2O2/c1-2-12(9-6-4-3-5-7-9)10(15)13-8-14-11(12)16/h3-7H,2,8H2,1H3,(H,13,15)(H,14,16) |
Antagonists: Activity in AR antagonist pathway
| Value | Source or prediction |
|---|---|
| inactive |
experimental value |
| antagonist |
Antagonists_model: Antagonist model (Evaluation set) |