Garcia-Sosa, A. T.; Maran, U. Combined Naïve Bayesian, chemical fingerprints, and molecular docking classifiers to model and predict androgen receptor binding activity data for environmentally- and health-sensitive substances. Int. J. Mol. Sci. 2021, 22, 6695.
Compound
| ID: | 623-03-0 | |
|---|---|---|
| Name: | 4-Chlorobenzonitrile | |
| Description: | ||
| Labels: | eval | |
| CAS: | 623-03-0 | |
| InChi Code: | InChI=1S/C7H4ClN/c8-7-3-1-6(5-9)2-4-7/h1-4H |
Properties
BindingClass: Activity in Androgen Receptor
| Value | Source or prediction |
|---|---|
| 0 |
experimental value |
| 0 |
Procedure_13: Multivariate Logistic Regression Model (Evaluation set) |