Garcia-Sosa, A. T.; Maran, U. Using combined docking, chemical fingerprints, and Bayesian classifiers for the androgen receptor binding activity of the CoMPARA data. Toxicological Sciences 2020.
Compound
| ID: | 106-63-8 | |
|---|---|---|
| Name: | Isobutyl acrylate | |
| Description: | ||
| Labels: | eval | |
| CAS: | 106-63-8 | |
| InChi Code: | InChI=1S/C7H12O2/c1-4-7(8)9-5-6(2)3/h4,6H,1,5H2,2-3H3 |
Properties
bindingClass: Androgen Receptor Binding Class
| Value | Source or prediction |
|---|---|
| 0 |
experimental value |
| 0.002194607 |
Proc.13: Procedure 13, Multivariate Logistic Regression (predicted Binding Class) |