| ID: | 60 | |
|---|---|---|
| Name: | Naphthalene | |
| Description: | ||
| Labels: | ||
| CAS: | 91-20-3 | |
| InChi Code: | InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H |
pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| -1.68 |
experimental value |
| -1.8 |
QSAR: Non polar narcosis (Training set) |