| ID: | 57 | |
|---|---|---|
| Name: | Trichloroethene | |
| Description: | ||
| Labels: | ||
| CAS: | 79-01-6 | |
| InChi Code: | InChI=1S/C2HCl3/c3-1-2(4)5/h1H |
pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| -2.53 |
experimental value |
| -2.48 |
QSAR: Non polar narcosis (Training set) |