| ID: | 56 | |
|---|---|---|
| Name: | 1,1,2-Trichloroethane | |
| Description: | ||
| Labels: | ||
| CAS: | 79-00-5 | |
| InChi Code: | InChI=1S/C2H3Cl3/c3-1-2(4)5/h2H,1H2 |
pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| -2.79 |
experimental value |
| -2.93 |
QSAR: Non polar narcosis (Training set) |