| ID: | 38 | |
|---|---|---|
| Name: | 2-Hexanone | |
| Description: | ||
| Labels: | ||
| CAS: | 591-78-6 | |
| InChi Code: | InChI=1S/C6H12O/c1-3-4-5-6(2)7/h3-5H2,1-2H3 |
pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| -3.63 |
experimental value |
| -3.69 |
QSAR: Non polar narcosis (Training set) |