| ID: | 35 | |
|---|---|---|
| Name: | Urethane | |
| Description: | ||
| Labels: | ||
| CAS: | 51-79-6 | |
| InChi Code: | InChI=1S/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5) |
pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| -4.77 |
experimental value |
| -4.92 |
QSAR: Non polar narcosis (Training set) |