| ID: | 31 | |
|---|---|---|
| Name: | 2,6-Dichlorobenzamide | |
| Description: | ||
| Labels: | ||
| CAS: | 2008-58-4 | |
| InChi Code: | InChI=1S/C7H5Cl2NO/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| -3.39 |
experimental value |
| -4.02 |
QSAR: Non polar narcosis (Training set) |