ID: | 91 | |
---|---|---|
Name: | pentabromophenol | |
Description: | ||
Labels: | training | |
CAS: | 608-71-9 | |
InChi Code: | InChI=1S/C6HBr5O/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
pEC50: 15-minute algal toxicity as log(1/EC50) [log(1/mM)] i
Value | Source or prediction |
---|---|
3.1 |
experimental value |
2.486 |
Eq5: MLR with logKow - non-polar narcosis (Training set) |
2.294 |
Eq6: MLR with logKow and LUMO (Training set) |
2.030 |
Eq7: MLR with logKow, LUMO and ∆1χv (Training set) |
2.059 |
Eq8: MLR with logKow, LUMO and ∆1χv (Training set) |
1.7086 |
Fig5: Non-linear kNN model, k = 7 (Training set) |
1.6212 |
Fig7: Non-linear kNN consensus model, k = 5, 6, 7 (Training set) |
Link | Resource description |
---|---|
DTXSID9022079 | US EPA CompTox Dashboard |