| ID: | 26 | |
|---|---|---|
| Name: | 2-Aminophenanthrene | |
| Description: | ||
| Labels: | ||
| CAS: | 3366-65-2 | |
| InChi Code: | InChI=1S/C14H11N/c15-12-7-8-14-11(9-12)6-5-10-3-1-2-4-13(10)14/h1-9H,15H2 |
TA100: Mutagenicity for strain TA100 + S9 metabolism [[lg(revertants/nmol)]]
| Value | Source or prediction |
|---|---|
| 2.74 |
experimental value |
Mutagenicity: Mutagenic class
| Value | Source or prediction |
|---|---|
| M |
experimental value |
| M |
Eq8ter: Mutagenic class of homocyclic aromatic amines (Mutagenic class. M - mutagenic; nM - non-mutagenic) |
| Link | Resource description |
|---|---|
| DTXSID00187340 | US EPA CompTox Dashboard |