| ID: | 8 | |
|---|---|---|
| Name: | Danofloxacin | |
| Description: | ||
| Labels: | pH5, Ampholyte | |
| CAS: | 112398-08-0 | |
| InChi Code: | InChI=1S/C19H20FN3O3/c1-21-7-12-4-11(21)8-22(12)17-6-16-13(5-15(17)20)18(24)14(19(25)26)9-23(16)10-2-3-10/h5-6,9-12H,2-4,7-8H2,1H3,(H,25,26)/t11-,12-/m0/s1 |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
| Value | Source or prediction |
|---|---|
| -6.69 |
experimental value |
| -6.94 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0046432 | US EPA CompTox Dashboard |