| ID: | 70 | |
|---|---|---|
| Name: | Perphenazine | |
| Description: | ||
| Labels: | pH9, Base | |
| CAS: | 58-39-9 | |
| InChi Code: | InChI=1S/C21H26ClN3OS/c22-17-6-7-21-19(16-17)25(18-4-1-2-5-20(18)27-21)9-3-8-23-10-12-24(13-11-23)14-15-26/h1-2,4-7,16,26H,3,8-15H2 |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
| Value | Source or prediction |
|---|---|
| -4.69 |
experimental value |
| -4.59 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (External validation set) |
| Link | Resource description |
|---|---|
| DTXSID1023441 | US EPA CompTox Dashboard |