ID: | 64 | |
---|---|---|
Name: | Indomethacine | |
Description: | ||
Labels: | pH3, Acid | |
CAS: | 53-86-1 | |
InChi Code: | InChI=1S/C19H16ClNO4/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,22,23) |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
Value | Source or prediction |
---|---|
-4.71 |
experimental value |
-5.05 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (External validation set) |
Link | Resource description |
---|---|
DTXSID9020740 | US EPA CompTox Dashboard |