| ID: | 60 | |
|---|---|---|
| Name: | Azelastine | |
| Description: | ||
| Labels: | pH9, Base | |
| CAS: | 58581-89-8 | |
| InChi Code: | InChI=1S/C22H24ClN3O/c1-25-13-4-5-18(12-14-25)26-22(27)20-7-3-2-6-19(20)21(24-26)15-16-8-10-17(23)11-9-16/h2-3,6-11,18H,4-5,12-15H2,1H3/t18-/m0/s1 |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
| Value | Source or prediction |
|---|---|
| -4.25 |
experimental value |
| -4.07 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (External validation set) |
| Link | Resource description |
|---|---|
| DTXSID6022638 | US EPA CompTox Dashboard |