| ID: | 28 | |
|---|---|---|
| Name: | Sarafloxacin | |
| Description: | ||
| Labels: | pH5, Ampholyte | |
| CAS: | 98105-99-8 | |
| InChi Code: | InChI=1S/C20H17F2N3O3/c21-12-1-3-13(4-2-12)25-11-15(20(27)28)19(26)14-9-16(22)18(10-17(14)25)24-7-5-23-6-8-24/h1-4,9-11,23H,5-8H2,(H,27,28) |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
| Value | Source or prediction |
|---|---|
| -7.42 |
experimental value |
| -7.23 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (Training set) |
| Link | Resource description |
|---|---|
| DTXSID8048494 | US EPA CompTox Dashboard |